SGX-523
SGX-523 is a selective Met (c-Met) inhibitor with IC50 of 4 nM, no activity to BRAFV599E, c-Raf, Abl and p38α. Phase 1.
| Trivial name | N/A |
| Catalog Number | S1112 |
| Molecular Formula | C27H50O6 |
| CAS# | 1022150-57-7 |
| Inchi | InChI=1S/C27H50O6/c1-4-7-10-13-16-19-25(28)31-22-24(33-27(30)21-18-15-12-9-6-3)23-32-26(29)20-17-14-11-8-5-2/h24H,4-23H2,1-3H3 |
| Inchi Key | VLPFTAMPNXLGLX-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCC |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/SGX-523.html |
| Additional Information | https://file.selleck.cn/downloads/struct/SGX-523-chemical-structure-S1112.gif |
