(±)-Trolline | MedChemExpress (MCE)
(±)-Trolline ((±)-Oleracein E), an isoquinoline alkaloid, exhibits antibacterial activity against respiratory bacteria and antiviral activity against influenza virus A and B. (±)-Trolline significantly induces HSC apoptosis. (±)-Trolline can be used for the research of liver fibrosis[1].
| Trivial name | (±)-Trolline |
| Catalog Number | HY-113806 |
| Alternative Name(s) | (±)-Oleracein E |
| Research Area | Inflammation/Immunology; Infection |
| CAS# | 1021950-79-7 |
| Purity | ≥98.00% |
| SMILES | O=C1N2CCC3=CC(O)=C(C=C3C2CC1)O |
| PubChem Chemical Structure ID | 21574476 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/racemic-trolline.html |