Tyrosine kinase inhibitor 5mg
Tyrosine-kinase inhibitor is a pharmaceutical drug that inhibits tyrosine kinases. Tyrosine kinases are enzymes responsible for the activation of many proteins by signal transduction cascades.
| Trivial name | Tyrosine kinase inhibitor 5mg |
| Catalog Number | A15267-5 |
| Alternative Name(s) | 1-N'-(4-fluorophenyl)-1-N-[4-[[2-(2-morpholin-4-ylethylcarbamoyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]phenyl]cyclopropane-1,1-dicarboxamide |
| Molecular Formula | C31H31FN6O5 |
| CAS# | 1021950-26-4 |
| SMILES | C1CC1(C(=O)NC2=CC=C(C=C2)OC3=C4C=C(NC4=NC=C3)C(=O)NCCN5CCOCC5)C(=O)NC6=CC=C(C=C6)F |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/tyrosine-kinase-inhibitor.html |
