Ancitabine HCl
Ancitabine HCl is the prodrug of cytarabine, which is a pyrimidine nucleoside analog that inhibits the DNA synthesis and used mainly in the treatment of leukemia.
| Trivial name | NSC 145668 HCl; Cyclocytidine HCl; Cyclo-CMP HCl; Cyclo-C |
| Catalog Number | CSN18759 |
| Alternative Name(s) | NSC 145668 HCl; Cyclocytidine HCl; Cyclo-CMP HCl; Cyclo-C |
| Research Area | Cancer |
| Molecular Formula | C9H12ClN3O4 |
| CAS# | 10212-25-6 |
| Purity | ≥98% |
| SMILES | O[C@@H]1[C@@H](CO)O[C@]2([H])[C@@]1([H])OC3=NC(C=CN32)=N.Cl |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/ancitabine-hcl.html |