Triclosan D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-T-62284 |
| Alternative Name(s) | 2,4,4-Trichloro-2-hydroxydiphenyl-d3 Ether;5-chloro-2-dichloro(D3)phenoxyphenol |
| Research Area | Used as bacteriostat and preservative for cosmetic and detergent compositions. Antiseptic, disinfectant. |
| Molecular Formula | C12H4D3Cl3O2 |
| CAS# | 1020719-98-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | ClC(C([2H])=C1Cl)=C(C([2H])=C1[2H])OC(C=CC(Cl)=C2)=C2O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST62284.html |
| Additional Information | NULL |