Sulfamethoxazole D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-K-00143 |
| Alternative Name(s) | 4-amino-N-(5-methylisoxazol-3-yl)benzenesulfonamide D4 |
| Research Area | Sulfamethoxazole-d4 is the isotopically labeled antibacterial drug Sulfamethoxazole. Sulfonamide antibiotics that block the synthesis of dihydrofolic acid by inhibiting the enzyme dihydropteroate synthase. An isotopically labeled antibacterial agent. Forensic & Clinical |
| Molecular Formula | C10H7D4N3O3S |
| CAS# | 1020719-86-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | [2H]C1=C([2H])C(=C([2H])C([2H])=C1N)S(=O)(=O)NC1=NOC(C)=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSK00143.html |
| Additional Information | NULL |