Paliperidone D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02683 |
| Alternative Name(s) | Hydroxy risperidone-D4;9-Hydroxyrisperidone D4;3-{2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-l](²H4)ethyl}-9-hydroxy-2-methyl-4H,6H,7H,8H,9H-pyrido[1,2-a]pyrimidin-4-one;CS-P-06994 |
| Research Area | Labeled Paliperidone, intended for use as an internal standard for the quantification of Paliperidone by GC- or LC-mass spectrometry. |
| Molecular Formula | C23H23D4FN4O3 |
| CAS# | 1020719-55-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | FC1=CC=C2C(ON=C2C3CCN(C([2H])([2H])C([2H])([2H])C(C(N(CCCC4O)C4=N5)=O)=C5C)CC3)=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02683.html |
| Additional Information | NULL |