SGI 1027 10mM * 1mL in DMSO
SGI 1027 is a DNMT inhibitor with IC50 of 6, 8, 7.5 ??M for DNMT1, DNMT3A, and DNMT3B, respectively.
| Trivial name | SGI 1027 10mM * 1mL in DMSO |
| Catalog Number | A14120-10mM-D |
| Alternative Name(s) | N-(4-((2-amino-6-methylpyrimidin-4-yl)amino)phenyl)-4-(quinolin-4-ylamino)benzamide |
| Molecular Formula | C27H23N7O |
| CAS# | 1020149-73-8 |
| SMILES | CC1=CC(=NC(=N1)N)NC2=CC=C(C=C2)NC(=O)C3=CC=C(C=C3)NC4=CC=NC5=CC=CC=C54 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/sgi-1027.html |
