Butenafine Hydrochloride
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-11614 |
| Alternative Name(s) | N-[[4-(1,1-Dimethylethyl)phenyl]methyl]-N-methyl-1-naphthalenemethanamine Hydrochloride |
| Research Area | An antifungal, used to control dermal fungal infections such as athletes foot and ring worm. |
| Molecular Formula | C23H27ClN |
| CAS# | 101827-46-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CN(CC1=CC=C(C(C)(C)C)C=C1)CC2=CC=CC3=C2C=CC=C3.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11614.html |
| Additional Information | NULL |