TG 100801 Hydrochloride 5mg
TG 100801 is the prodrug of TG 100572 (HY-10184), TG 100572 is a multi-targeted kinase inhibitor that inhibit select growth factor receptor tyrosine kinases and Src familt kinases with IC50 values of 2/7/2/1/0.5 nM or VEGFR1/VEGFR2/FGFR1/Src/Fyn kianse respectively.
| Trivial name | TG 100801 Hydrochloride 5mg |
| Catalog Number | A15261-5 |
| Alternative Name(s) | [4-chloro-3-[5-methyl-3-[4-(2-pyrrolidin-1-ylethoxy)anilino]-1,2,4-benzotriazin-7-yl]phenyl] benzoate;hydrochloride |
| Molecular Formula | C33H31Cl2N5O3 |
| CAS# | 1018069-81-2 |
| SMILES | CC1=C2C(=CC(=C1)C3=C(C=CC(=C3)OC(=O)C4=CC=CC=C4)Cl)N=NC(=N2)NC5=CC=C(C=C5)OCCN6CCCC6.Cl |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/tg-100801-hydrochloride.html |
