Olanzapine Thiolactam Impurity
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-10378 |
| Alternative Name(s) | Olanzapine Thiolactam Impurity;Lactum Thiolactum;(1Z)-1-[4,5-Dihydro-2-(4-methyl-1-piperazinyl)-4-thioxo-3H-1,5-benzodiazepin-3-ylidene]-2-propanone |
| Research Area | A degradation product of Olanzapine in solid oral formulations. Impurity in commercial preparations of Olanzapine. |
| Molecular Formula | C17H20N4OS |
| CAS# | 1017241-36-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(/C=C1C(N2CCN(C)CC2)=NC3=CC=CC=C3NC/1=S)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10378.html |
| Additional Information | NULL |