Z57346765 | MedChemExpress (MCE)
Z57346765 is a PGK1-specific inhibitor that reduces the activity of metabolic enzymes in PGK1 glycolysis and inhibits PGK1-dependent cell proliferation. Z57346765 exerts inhibitory effects against clear cell renal cell carcinoma (KIRC)[1].
| Trivial name | Z57346765 |
| Catalog Number | HY-W195984 |
| Research Area | Cancer |
| CAS# | 1016340-64-9 |
| Purity | 99.6% |
| SMILES | OCCNC1=C2C=CC=CC2=NC(NC3=CC=C(C)C=C3)=N1 |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/z57346765.html |