Kadsuracoccinic acid A | MedChemExpress (MCE)
Kadsuracoccinic acid A is a tetracyclic natural compound that can be isolated from the stems of Kadsura coccinea. Kadsuracoccinic acid A has vitro anti-HIV-1 activitiy with an EC50 value of 68.7 μM[1].
| Trivial name | Kadsuracoccinic acid A |
| Catalog Number | HY-113818 |
| Research Area | Infection |
| CAS# | 1016260-22-2 |
| Purity | ≥98.00% |
| SMILES | O=C(O)CC[C@@]1(C)[C@H](C(C)=C)CC[C@@](C1=CC[C@]/23C)([H])[C@]3(C)CCC2=C(C)\CC/C=C(C(O)=O)/C |
| PubChem Chemical Structure ID | 24850148 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/kadsuracoccinic-acid-a.html |