Norfloxacin-D5 (ethyl-D5)
Marine
| Trivial name | NULL |
| Catalog Number | CS-O-10118 |
| Alternative Name(s) | Norfloxacin-D5 ;1-(²H5)ethyl-6-fluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3carboxylc cid |
| Research Area | A labeled antibacterial agent. Norfloxacin-d5 is a labeled synthetic fluoroquinolone antibacterial agent.;Labeled Norfloxacin, intended for use as an internal standard for the quantification of Norfloxacin by GC- or LC-mass spectrometry. |
| Molecular Formula | C16H13D5FN3O3 |
| CAS# | 1015856-57-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1C2=CC(F)=C(N3CCNCC3)C=C2N(C=C1C(O)=O)C([2H])([2H])C([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10118.html |
| Additional Information | NULL |
