Ipronidazole D3
Marine
| Trivial name | NULL |
| Catalog Number | CS-W-00124 |
| Alternative Name(s) | 1-(D3)methyl-5-nitro-2-(propan-2-yl)-1H-imidazole |
| Research Area | Labeled Ipronidazole, intended for use as an internal standard for the quantification of Ipronidazole by GC- or LC-mass spectrometry. |
| Molecular Formula | C7D3H8N3O2 |
| CAS# | 1015855-83-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(C1=NC=C([N](=O)=O)N1C([2H])([2H])[2H])C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSW00124.html |
| Additional Information | NULL |