Tenovin-6 5mg
Tenovin-6 is a analog of tenovin-1. Tenovin-6 inhibits the protein deacetylase activities of purified human SIRT1, SIRT2, and SIRT3 in vitro with IC50 values of 21, 10, and 67 uM, respectively.
| Trivial name | Tenovin-6 5mg |
| Catalog Number | A12305-5 |
| Alternative Name(s) | N-?[[[4-?[[5-?(dimethylamino)-?1-?oxopentyl]amino]phenyl]amino]thioxomethyl]-?4-?(1,?1-?dimethylethyl)-?benzamide |
| Molecular Formula | C25H34N4O2S |
| CAS# | 1011557-82-6 |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)NC(=S)NC2=CC=C(C=C2)NC(=O)CCCCN(C)C |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/tenovin-6.html |
