Pyridostigmine D3 Bromide
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-31044 |
| Alternative Name(s) | 3-[(dimethylcarbamoyl)oxy]-1-(D3)methylpyridin-1- ium bromide |
| Research Area | Labeled Pyridostigmine, intended for use as an internal standard for the quantification of Pyridostigmine by GC- or LC-mass spectrometry. |
| Molecular Formula | C9H10D3BrN2O2 |
| CAS# | 101-26-8 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N(C)C)OC1=C[N+](C([2H])([2H])[2H])=CC=C1.[Br-] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO31044.html |
| Additional Information | NULL |