Levofloxacin
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-01741 |
| Alternative Name(s) | (S)-9-fluoro-3-methyl-10-(4-methylpiperazin-1-yl)-7-oxo-3,7-dihydro-2H-[1,4]oxazino[2,3,4-ij]quinoline |
| Research Area | A synthetic fluoroquinolone antibacterial agent that inhibits the supercoiling activity of bacterial DNA GYRASE, halting DNA REPLICATION. |
| Molecular Formula | C18H20FN3O4 |
| CAS# | 100986-85-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1C2=CC(F)=C(N3CCN(C)CC3)C(OC[C@@H]4C)=C2N4C=C1C(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01741.html |
| Additional Information | NULL |