CX-4945 (Silmitasertib) 10mM * 1mL in DMSO
CX-4945 is a potent and selective orally bioavailable small molecule inhibitor of CK2 that inhibits human umbilical vein endothelial cell migration, tube formation, and blocks CK2-dependent hypoxia-induced factor 1 alpha (HIF-1??) transcription in cancer cells.
| Trivial name | CX-4945 (Silmitasertib) 10mM * 1mL in DMSO |
| Catalog Number | A11060-10mM-D |
| Alternative Name(s) | 5-[(3-Chlorophenyl)amino]benzo[c]-2,6-naphthyridine-8-carboxylic acid |
| Molecular Formula | C19H12ClN3O2 |
| CAS# | 1009820-21-6 |
| SMILES | C1=CC(=CC(=C1)Cl)NC2=C3C=CN=CC3=C4C=CC(=CC4=N2)C(=O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/cx-4945-silmitasertib.html |