AZD8055 25mg
AZD8055 is a potent, selective, and orally bioavailable ATP-competitive mTOR kinase inhibitor with an IC50 of 0.8 nM.
| Trivial name | AZD8055 25mg |
| Catalog Number | A10114-25 |
| Alternative Name(s) | [5-[2,4-Bis((3S)-3-methylmorpholin-4-yl)pyrido[2,3-d]pyrimidin-7-yl]-2-methoxyphenyl]methanol |
| Molecular Formula | C25H31N5O4 |
| CAS# | 1009298-09-2 |
| SMILES | C[C@H]1COCCN1C2=NC(=NC3=C2C=CC(=N3)C4=CC(=C(C=C4)OC)CO)N5CCOC[C@@H]5C |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/azd8055.html |
