SIS3
SIS3 is a cell-permeable inhibitor of Smad3 that selectively inhibits TGF-β1-dependent Smad3 phosphorylation and Smad3-mediated cellular signaling. SIS3 reduces TGF-β1-induced type 1 procollagen expression and myofibroblast differentiation in normal dermal fibroblasts as well as scleroderma fibroblasts.
| Trivial name | N/A |
| Catalog Number | S3552 |
| Molecular Formula | C28H27N3O3 |
| CAS# | 1009104-85-1 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | COC1=CC2=C(CN(CC2)C(=O)\C=C\C3=C([N](C)C4=NC=CC=C34)C5=CC=CC=C5)C=C1OC |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/sis3.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s3552-sis3-chemical-structure.gif |