11-Deoxy-11-methylene PGD2 | MedChemExpress (MCE)
11-Deoxy-11-methylene PGD2 (11d-11m-PGD2) is a chemically stable, isosteric analogue of Prostaglandin 2 in which the 11-keto group is replaced by an exocyclic methylene. 11-Deoxy-11-methylene PGD2 is significantly stimulating the storage of fats suppressed in the presence of Indomethacin[1].
| Trivial name | 11-Deoxy-11-methylene PGD2 |
| Catalog Number | HY-112533 |
| Alternative Name(s) | 11d-11m-PGD2; 11-Deoxy-11-Methylene prostaglandin D2 |
| Research Area | Endocrinology |
| CAS# | 100648-29-1 |
| Purity | ≥98.0% |
| SMILES | OC(CCC/C=C\C[C@@H]1[C@H](C(C[C@@H]1O)=C)/C=C/[C@@H](O)CCCCC)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/11-deoxy-11-methylene-pgd2.html |