Desloratadine
High affinity histamine H1 receptor antagonist Neuroscience|Histamine Receptor
| Catalog Number | B1571-S |
| Research Area | Neuroscience|Histamine Receptor |
| Molecular Formula | C19H19ClN2 |
| CAS# | 100643-71-8 |
| Purity | 99.65% |
| SMILES | C1CC2=C(C=CC(=C2)Cl)C(=C3CCNCC3)C4=C1C=CC=N4 |
| Size | Evaluation Sample |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1571 |
