Cyclohexanone D4
Deuterated Building Blocks
| Trivial name | NULL |
| Catalog Number | CS-BX-00304 |
| Alternative Name(s) | Cyclohexanone-2,2,6,6-d4;Cyclohexanon- D4 |
| Research Area | Labeled Cyclohexanone, intended for use as an internal standard for the quantification of Cyclohexanone by GC- or LC-mass spectrometry. |
| Molecular Formula | C6H6D4O |
| CAS# | 1006-03-07 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1C([2H])([2H])CCCC1([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSBX00304.html |
| Additional Information | NULL |