Verapamil-d7 | MedChemExpress (MCE)
Verapamil-d7 is the deuterium labeled Verapamil (HY-14275). Verapamil ((±)-Verapamil) is a calcium channel blocker and a potent and orally active first-generation P-glycoprotein (P-gp) inhibitor. Verapamil also inhibits CYP3A4. Verapamil has the potential for high blood pressure, heart arrhythmias and angina research[1][2][3].
| Trivial name | Verapamil-d7 |
| Catalog Number | HY-14275S1 |
| Alternative Name(s) | (±)-Verapamil-d7; CP-16533-1-d7 |
| Research Area | Metabolic Disease; Cancer |
| CAS# | 100578-79-8 |
| Purity | ≥98.0% |
| SMILES | [2H]C(C(CCCN(CCC1=CC(OC)=C(C=C1)OC)C)(C2=CC(OC)=C(C=C2)OC)C#N)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/verapamil-d7.html |