αvβ5 integrin-IN-2 | MedChemExpress (MCE)
αvβ5 integrin-IN-2 (Cpd_AV2) is an αvβ5 integrin inhibitor that disrupts the stability of integrin heterodimers. αvβ5 integrin-IN-2 targets the β-propeller central pocket of ITGAV (integrin αV). αvβ5 integrin-IN-2 induces cellular apoptosis[1].
| Trivial name | αvβ5 integrin-IN-2 |
| Catalog Number | HY-163333 |
| Research Area | Cancer |
| CAS# | 1005104-60-8 |
| Purity | ≥98.0% |
| SMILES | CC(CC(NCCN1)C(C=C2)=CC3=C2C=CC=C3)NCCNC(C)CC1C4=CC=C5C(C=CC=C5)=C4 |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/αvβ5-integrin-in-2.html |