1-Methylnicotinamide chloride
1-Methylnicotinamide (1-MNA, 3-Carbamoyl-1-methylpyridin-1-ium, Trigonellamide) chloride is an active endogenous metabolite of nicotinamide that exhibits anti-inflammatory and anti-thrombotic activities. 1-Methylnicotinamide enhances tumor vasculature formation and markedly increases prostacyclin (PGI2) generation.
| Trivial name | 1-MNA, 3-Carbamoyl-1-methylpyridin-1-ium chloride, Trigonellamide chloride |
| Catalog Number | S3346 |
| Molecular Formula | C7H9ClN2O |
| CAS# | 1005-24-9 |
| SMILES | [Cl-].C[N+]1=CC=CC(=C1)C(N)=O |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/1-methylnicotinamide-chloride.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s3346-1-methylnicotinamide-chloride-chemical-structure.gif |