Cobicistat(GS-9350) 10mM * 1mL in DMSO
Cobicistat is a potent inhibitor of cytochrome P450 3A enzymes, including the important CYP3A4 subtype. It also inhibits intestinal transport proteins, increasing the overall absorption of several HIV medications, including atazanavir, darunavir and tenofovir alafenamide fumarate.
| Trivial name | Cobicistat(GS-9350) 10mM * 1mL in DMSO |
| Catalog Number | A11277-10mM-D |
| Alternative Name(s) | Thiazol-5-ylmethyl?N-[1-benzyl-4-[[2-[[(2-isopropylthiazol-4-yl)methyl-methyl-carbamoyl]amino]-4-morpholino-butanoyl]amino]-5-phenyl-pentyl]carbamate |
| Molecular Formula | C40H53N7O5S2 |
| CAS# | 1004316-88-4 |
| SMILES | CC(C)C1=NC(=CS1)CN(C)C(=O)N[C@@H](CCN2CCOCC2)C(=O)N[C@H](CC[C@H](CC3=CC=CC=C3)NC(=O)OCC4=CN=CS4)CC5=CC=CC=C5 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/cobicistat-gs-9350.html |