Cobicistat 5mg
Cobicistat is a potent inhibitor of cytochrome P450 3A enzymes, including the important CYP3A4 subtype. It also inhibits intestinal transport proteins, increasing the overall absorption of several HIV medications, including atazanavir, darunavir and tenofovir alafenamide fumarate.
| Trivial name | Cobicistat 5mg |
| Catalog Number | A11277-5 |
| Alternative Name(s) | Thiazol-5-ylmethyl?N-[1-benzyl-4-[[2-[[(2-isopropylthiazol-4-yl)methyl-methyl-carbamoyl]amino]-4-morpholino-butanoyl]amino]-5-phenyl-pentyl]carbamate |
| Molecular Formula | C40H53N7O5S2 |
| CAS# | 1004316-88-4 |
| SMILES | CC(C)C1=NC(=CS1)CN(C)C(=O)N[C@@H](CCN2CCOCC2)C(=O)N[C@H](CC[C@H](CC3=CC=CC=C3)NC(=O)OCC4=CN=CS4)CC5=CC=CC=C5 |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/cobicistat-gs-9350.html |
