Sodium picosulfate
Sodium Picosulfate inhibits absorption of water and electrolytes, and increases their secretion.Sodium Picosulphate treatment for long-term has no effects on neuropeptide content of the rat colon.
| Catalog Number | API10040456 |
| Alternative Name(s) | Picosulfate sodium Laxoberon Laxoberal |
| Research Area | Water, Electrolytes and Acid-Base Balance Regulating APIs |
| Molecular Formula | C₁₈H₁₃NNa₂O₈S₂ |
| CAS# | 10040-45-6 |
| SMILES | C1=CC=NC(=C1)C(C2=CC=C(C=C2)OS(=O)(=O)[O-])C3=CC=C(C=C3)OS(=O)(=O)[O-].[Na+].[Na+] |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/sodium-picosulfate-item-8112.html |