NY0116 | MedChemExpress (MCE)
NY0116 is a neuromedin U receptor 2 (NMUR2) agonist with EC50 values of 27.76 μM for hNMUR1 and 13.61 μM for hNMUR2. NY0116 decreases cAMP while stimulating calcium signaling in stably expressing NMUR2 HEK293 cells[1].
| Trivial name | NY0116 |
| Catalog Number | HY-124681 |
| Research Area | Metabolic Disease |
| CAS# | 1003000-59-6 |
| Purity | ≥98.0% |
| SMILES | NC(NCCOC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)=N |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ny0116.html |