L-Rhamnose Monohydrate
L-Rhamnose Monohydrate is a deoxy sugar found in plants and bacteria which can slow down gastric emptying and elevate serum propionate levels.
| Trivial name | Rham Monohydrate |
| Catalog Number | CSN10147 |
| Alternative Name(s) | Rham Monohydrate |
| Research Area | / |
| Molecular Formula | C6H14O6 |
| CAS# | 10030-85-0 |
| Purity | ≥98% |
| SMILES | C[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)C=O.[H]O[H] |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/l-rhamnose-monohydrate.html |