Irinotecan Hydrochloride
A semisynthetic camptothecin derivative that inhibits DNA TOPOISOMERASE I to prevent nucleic acid synthesis during S PHASE. It is used as an antineoplastic agent for the treatment of COLORECTAL NEOPLASMS and PANCREATIC NEOPLASMS.
| Catalog Number | API100286906 |
| Alternative Name(s) | Irinotecan Hcl Topotecin Campto |
| Research Area | Anti-Tumor APIs |
| Molecular Formula | C33H39ClN4O6 |
| CAS# | 100286-90-6 |
| SMILES | CCC1=C2CN3C(=CC4=C(C3=O)COC(=O)C4(CC)O)C2=NC5=C1C=C(C=C5)OC(=O)N6CCC(CC6)N7CCCCC7.Cl |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/irinotecan-hydrochloride-item-12174.html |