Zaleplon D5
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02826 |
| Alternative Name(s) | N-[3-l)phenyl]-N-ethyl-d846-d5; Sonata-d5;N-[3-(3cyanopyrazolo[1,5-a]pyrimidin-7-yl)phenyl]-N-ethyl-d5-cetamide;cL-284846-d5; |
| Research Area | Selective non-benzodiazepine GABAA receptor agonist.;Labeled Zaleplon, intended for use as an internal standard for the quantification of Zaleplon by GC- or LC-mass spectrometry. |
| Molecular Formula | C17H10D5N5O |
| CAS# | 1001083-56-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | N#CC1=C(N=CC=C2C3=CC(N(C([2H])([2H])C([2H])([2H])[2H])C(C)=O)=CC=C3)N2N=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02826.html |
| Additional Information | NULL |
