4-Nitroacetophenone
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-O-16180 |
| Alternative Name(s) | 4?-Nitroacetophenone; 1-(4-nitrophenyl)ethan-1-one; p-Nitro-acetophenone |
| Research Area | 4?-Nitroacetophenone is used as a reagent in the synthesis of 4-Nitroacetophenone thiosemicarbazone derivatives and their copper(II) complexes which have potential anti-trypanosomal activity in vitro. Also used as a reagent in the synthesis of (R)-(4-Nitrophenyl)oxirane (N504430) and (S)-(4-Nitrophenyl)oxirane (N504435). |
| Molecular Formula | C8H7NO3 |
| CAS# | 100-19-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(C1=CC=C([N+]([O-])=O)C=C1)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO16180.html |
| Additional Information | NULL |