Nobiletin
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-T-37359 |
| Alternative Name(s) | Nobiletin;2-(3,4-Dimethoxyphenyl)-5,6,7,8-tetramethoxy-4H-1-benzopyran-4-one;2-(3,4-dimethoxyphenyl)-5,6,7,8-tetramethoxy-4H-chromen-4-one |
| Research Area | Nobiletin is an O-methylated flavone, a flavonoid isolated from citrus peels like in tangerine. It is a potent antioxidant with good bioavailability. Nobiletin directly inhibits the ATP-binding cassette proteins P-glycoprotein and breast cancer resistance protein. |
| Molecular Formula | C21H22O8 |
| CAS# | 0478-01-03 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | COC1=C(C2=O)C(OC(C3=CC(OC)=C(OC)C=C3)=C2)=C(OC)C(OC)=C1OC |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST37359.html |
| Additional Information | NULL |