Erythromycin
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-11641 |
| Alternative Name(s) | Erythromycin A;Eryth,4S,5S,6R,7R,9R,11R,12R,13S,14R)-6-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-14-ethyl-7,12,13-trihydroxy-4-[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,10-dione;CS-O-11000 |
| Research Area | Erythromycin is bacteriostatic antibiotic macrolide produced by Streptomyces erythreus. Erythromycin A is considered its major active component. In sensitive organisms, it inhibits protein synthesis by binding to 50S ribosomal subunits. This binding process inhibits peptidyl transferase activity and interferes with translocation of amino acids during translation and assembly of proteins. |
| Molecular Formula | C37H67NO13 |
| CAS# | 0114-07-08 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@H]([C@@H]([C@H](C(O[C@@H]1CC)=O)C)O[C@@](O[C@@H](C)[C@@H]2O)([H])C[C@@]2(C)OC)[C@H]([C@](O)(C[C@H](C([C@@H]([C@@H](O)[C@@]1(O)C)C)=O)C)C)O[C@@](O[C@H](C)C[C@@H]3N(C)C)([H])[C@@H]3O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11641.html |
| Additional Information | NULL |
