Tyrosine is a nutritional supplement.
| Catalog Number | API0233345 |
| Alternative Name(s) | L-tyrosine; tyrosine; 60-18-4 |
| Research Area | API |
| Molecular Formula | C9H11NO3 |
| CAS# | 60-18-4 |
| Inchi | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1 |
| Inchi Key | OUYCCCASQSFEME-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)O)N)O |
| Size | inquiry |
| Supplier Page | https://apihub.protheragen.ai/tyrosine-item-1845.html |
Tyrosine is a non-essential amino acid. In animals it is synthesized from [phenylalanine]. It is also the precursor of [epinephrine], thyroid hormones, and melanin.
| Catalog Number | PIPB-0108 |
| Alternative Name(s) | L-tyrosine tyrosine (S)-Tyrosine p-Tyrosine |
| Research Area | Amino acids and derivatives |
| Molecular Formula | C9H11NO3 |
| CAS# | 60-18-4 |
| SMILES | C1=CC(=CC=C1CC(C(=O)O)N)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen.ai/tyrosine-item-10226.html |
