Lenacapavir Sodium is an anti-HIV drug.
| Catalog Number | API0233311 |
| Alternative Name(s) | Lenalidomide; 191732-72-6; Revimid |
| Research Area | API |
| Molecular Formula | C13H13N3O3 |
| CAS# | 191732-72-6 |
| Inchi | InChI=1S/C13H13N3O3/c14-9-3-1-2-7-8(9)6-16(13(7)19)10-4-5-11(17)15-12(10)18/h1-3,10H,4-6,14H2,(H,15,17,18) |
| Inchi Key | GOTYRUGSSMKFNF-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC=C3N |
| Size | inquiry |
| Supplier Page | https://apihub.protheragen.ai/lenalidomide-item-1811.html |
It has a role as an angiogenesis inhibitor, an antineoplastic agent and an immunomodulator. It is a member of isoindoles, a dicarboximide, a member of piperidones and an aromatic amine.
| Catalog Number | API191732726 |
| Alternative Name(s) | Revlimid Revimid 3-(4-Amino-1-oxoisoindolin-2-yl)piperidine-2,6-dione |
| Research Area | Anti-Tumor APIs |
| Molecular Formula | C13H13N3O3 |
| CAS# | 191732-72-6 |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC=C3N |
| Size | inquiry |
| Supplier Page | https://www.protheragen.ai/lenalidomide-item-5882.html |
