Hydromorphone Hydrochloride is an opioid analgesic.
| Catalog Number | API0233148 |
| Alternative Name(s) | hydroquinone; 123-31-9; Benzene-1,4-diol |
| Research Area | API |
| Molecular Formula | C6H6O2 |
| CAS# | 123-31-9 |
| Inchi | InChI=1S/C6H6O2/c7-5-1-2-6(8)4-3-5/h1-4,7-8H |
| Inchi Key | QIGBRXMKCJKVMJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1O)O |
| Size | inquiry |
| Supplier Page | https://apihub.protheragen.ai/hydroquinone-item-1648.html |
It has a role as a cofactor, a carcinogenic agent, an Escherichia coli metabolite, a human xenobiotic metabolite, a skin lightening agent, an antioxidant and a mouse metabolite. It is a benzenediol and a member of hydroquinones.
| Catalog Number | API123319 |
| Alternative Name(s) | Benzene-1,4-diol 1,4-benzenediol Quinol |
| Research Area | Other APIs |
| Molecular Formula | C6H6O2 |
| CAS# | 123-31-9 |
| SMILES | C1=CC(=CC=C1O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen.ai/hydroquinone-item-11991.html |
