Ascorbic Acid is vitamin C.
| Catalog Number | API0232539 |
| Alternative Name(s) | l-ascorbic acid; ascorbic acid; vitamin C |
| Research Area | API |
| Molecular Formula | C6H8O6 |
| CAS# | 50-81-7 |
| Inchi | InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 |
| Inchi Key | CIWBSHSKHKDKBQ-JLAZNSOCSA-N |
| SMILES | C([C@@H]([C@@H]1C(=C(C(=O)O1)O)O)O)O |
| Size | inquiry |
| Supplier Page | https://apihub.protheragen.ai/ascorbic-acid-item-1039.html |
L-ascorbic acid is the L-enantiomer of ascorbic acid and conjugate acid of L-ascorbate. It has a role as a coenzyme, a flour treatment agent, a food antioxidant, a plant metabolite, a cofactor, a skin lightening agent, a geroprotector and a food colour retention agent.
| Catalog Number | CHE50817 |
| Alternative Name(s) | l-ascorbic acid ascorbic acid vitamin C L-ascorbate |
| Research Area | Chemicals |
| Molecular Formula | C6H8O6 |
| CAS# | 50-81-7 |
| SMILES | C(C(C1C(=C(C(=O)O1)O)O)O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen.ai/ascorbic-acid-item-8356.html |
