Felbamate is an antiepileptic drug.
| Catalog Number | API0232316 |
| Alternative Name(s) | felodipine; 72509-76-3; Flodil |
| Research Area | API |
| Molecular Formula | C18H19Cl2NO4 |
| CAS# | 72509-76-3 |
| Inchi | InChI=1S/C18H19Cl2NO4/c1-5-25-18(23)14-10(3)21-9(2)13(17(22)24-4)15(14)11-7-6-8-12(19)16(11)20/h6-8,15,21H,5H2,1-4H3 |
| Inchi Key | RZTAMFZIAATZDJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C(C1C2=C(C(=CC=C2)Cl)Cl)C(=O)OC)C)C |
| Size | inquiry |
| Supplier Page | https://apihub.protheragen.ai/felodipine-item-816.html |
A calcium-channel blocker, it lowers blood pressure by reducing peripheral vascular resistance through a highly selective action on smooth muscle in arteriolar resistance vessels. It is used in the management of hypertension and angina pectoris. It has a role as a calcium channel blocker, an antihypertensive agent, a vasodilator agent and an anti-arrhythmia drug.
| Catalog Number | API72509763 |
| Alternative Name(s) | Plendil Flodil Splendil |
| Research Area | Cardiovascular and Geriatric Medicine APIs |
| Molecular Formula | C18H19Cl2NO4 |
| CAS# | 72509-76-3 |
| SMILES | CCOC(=O)C1=C(NC(=C(C1C2=C(C(=CC=C2)Cl)Cl)C(=O)OC)C)C |
| Size | inquiry |
| Supplier Page | https://www.protheragen.ai/felodipine-item-6243.html |
