Guanfacine Hydrochloride is used for ADHD or hypertension, primarily for ADHD.
| Catalog Number | API0231851 |
| Alternative Name(s) | Guanidine hydrochloride; 18264; Guanidinium chloride |
| Research Area | API |
| Molecular Formula | CH6ClN3 |
| CAS# | 50-01-1 |
| Inchi | InChI=1S/CH5N3.ClH/c2-1(3)4;/h(H5,2,3,4);1H |
| Inchi Key | PJJJBBJSCAKJQF-UHFFFAOYSA-N |
| SMILES | C(=N)(N)N.Cl |
| Size | inquiry |
| Supplier Page | https://apihub.protheragen.ai/guanidine-hydrochloride-item-351.html |
Guanidine hydrochloride enhances the release of acetylcholine following a nerve impulse and potentiates acetylcholine actions on muscarinic and nicotinic receptors. It also appears to slow the rates of depolarization and repolarization of muscle cell membranes.
| Catalog Number | CHE50011 |
| Alternative Name(s) | Guanidinium chloride guanidine HCl Aminoformamidine hydrochloride |
| Research Area | Chemicals |
| Molecular Formula | CH6ClN3 |
| CAS# | 50-01-1 |
| SMILES | C(=N)(N)N.Cl |
| Size | inquiry |
| Supplier Page | https://www.protheragen.ai/guanidine-hydrochloride-item-8361.html |
