Potassium Chloride is an antituberculosis drug.
| Catalog Number | API0231702 |
| Alternative Name(s) | Potassium citrate; Potassium citrate anhydrous; Litocit |
| Research Area | API |
| Molecular Formula | C6H9KO7 |
| CAS# | ,866-84-2 |
| Inchi | InChI=1S/C6H8O7.K.H/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);; |
| Inchi Key | JOSYFFAWJFRGHM-UHFFFAOYSA-N |
| SMILES | C(O)(C(=O)O)(CC(=O)O)CC(=O)O.[KH] |
| Size | inquiry |
| Supplier Page | https://apihub.protheragen.ai/potassium-citrate-item-202.html |
Potassium citrate is used to treat a kidney stone condition called renal tubular acidosis. Potassium Citrate is indicated also for the management of Hypocitraturic calcium oxalate nephrolithiasis.
| Catalog Number | CHE866842 |
| Alternative Name(s) | TRIPOTASSIUM CITRATE Potassium citrate anhydrous Kaliksir |
| Research Area | Chemicals |
| Molecular Formula | K3C6H5O7 |
| CAS# | 866-84-2 |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.[K+].[K+].[K+] |
| Size | inquiry |
| Supplier Page | https://www.protheragen.ai/potassium-citrate-item-8976.html |
