Selenomethionine
Selenomethionine (Seleno-DL-methionine, DL-Selenomethionine) is a naturally occurring amino acid containing selenium. Selenomethionine (SeMet) can substitute for methionine (Met) during protein synthesis in a non-specific manner. Due to the significant differences in their redox properties, the incorporation of SeMet in place of Met may adversely impact protein function.
| Trivial name | Seleno-DL-methionine, DL-Selenomethionine |
| Catalog Number | S5970 |
| Molecular Formula | C21H22N2O3 |
| CAS# | 1464-42-2 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CCN(C(=O)C1=C(O)C2=C(CC)C=CC=C2N(C)C1=O)C3=CC=CC=C3 |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/selenomethionine.html |
| Additional Information | https://file.selleck.cn/downloads/struct/S5970-Selenomethionine-chemical-structure.png |
