Tacrolimus monohydrate
Tacrolimus monohydrate (Tacrolimus, FK506) is a macrolide antibiotic that primarily acts as an inhibitor of calcineurin phosphatase by binding to FK506 binding protein (FKBP). This inhibition blocks calcium-dependent processes, including interleukin-2 gene transcription, nitric oxide synthase activation, cell degranulation, and apoptosis, and also has immunosuppressive, neuroregenerative and neuroprotective properties.
| Trivial name | Tacrolimus, FK506 |
| Catalog Number | S5788 |
| Molecular Formula | C11H20ClNO3S |
| CAS# | 109581-93-3 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC(C)(C)CN(C1CC[S](=O)(=O)C1)C(=O)CCl |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/tacrolimus-monohydrate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/S5788-Tacrolimus-monohydrate-chemical-structure.png |
