Filipin complex
Filipin complex is a potent polyene macrolide antifungal antibiotic that integrates into membranes, sequestering cholesterol into complexes. Its treatment reduces PRRSV genome copies by 61% and lowers the PRRSV titer. It also acts as a fluorescent histochemical stain prone to autooxidation, commonly used in diagnosing Niemann-Pick Disease Type C (NP-C), a neurodegenerative lysosomal storage disorder. Researchers also employ it to study unesterified cholesterol distribution in cell and animal models of neurodegenerative diseases like NP-C and Sanfilippo syndrome (MPS IIIA).
| Catalog Number | E8153 |
| Molecular Formula | C29H36O15 |
| CAS# | 11078-21-0 |
| Inchi | InChI=1S/C29H36O15/c1-11-22(32)24(34)26(36)28(41-11)40-10-20-23(33)25(35)27(37)29(44-20)42-13-7-18(39-3)21-15(31)9-17(43-19(21)8-13)12-4-5-16(38-2)14(30)6-12/h4-8,11,17,20,22-30,32-37H,9-10H2,1-3H3/t1 1-,17-,20+,22-,23+,24+,25-,26+,27+,28+,29+/m0/s1 |
| Inchi Key | DXLXVXKGRBYXPK-SLRPQMTOSA-N |
| SMILES | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C4C(=O)CC(OC4=C3)C5=CC(=C(C=C5)OC)OC)O)O)O)O)O)O)O |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/filipin-complex.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e8153-filipin-complex-chemical-structure-tube.png |
