NADP sodium hydrate
NADP sodium hydrate is the sodium salt hydrate form of NADP (HY-113325). NADP is a coenzyme involved in cellular electron transfer reactions in biological metabolism, which is alternately oxidized (NADP+) and reduced (NADPH), and can maintain cellular redox homeostasis and regulate many biological events, including cellular metabolism. NADPH is a universal electron donor that provides reducing ability for synthetic metabolic reactions and redox balance. NADPH plays a multifunctional role in regulating inflammation, redox homeostasis, and synthetic metabolism processes.
Catalog Number | E8021 |
Molecular Formula | C19H12ClN3O2 |
CAS# | 698999-85-8 |
Inchi | InChI=1S/C19H12ClN3O2/c20-12-2-1-3-13(9-12)22-18-15-6-7-21-10-16(15)14-5-4-11(19(24)25)8-17(14)23-18/h1-10H,(H,22,23)(H,24,25) |
Inchi Key | MUOKSQABCJCOPU-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)Cl)NC2=NC3=C(C=CC(=C3)C(=O)O)C4=C2C=CN=C4 |
Size | 1g |
Supplier Page | http://www.selleckchem.com/products/nadp-sodium-hydrate.html |
Additional Information | https://file.selleck.cn/downloads/struct/e8021-nadp-sodium-hydrate-chemical-structure-tube.png |