Ac4ManNAz (80% α isomer)
Ac4ManNAz is an azido-containing metabolic glycoprotein labeling reagent. Ac4ManNAz can be used to selectively modify proteins. Ac4ManNAz can be used in cell labeling, tracking and proteomic analysis. Ac4ManNAz is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Catalog Number | E7558 |
| Molecular Formula | C13H8ClN3O2 |
| CAS# | 361154-30-5 |
| SMILES | [O-][N+](=O)C1=CC=C2N=C([NH]C2=C1)C3=CC=C(Cl)C=C3 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/ac4mannaz-80-alpha-isomer.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e7558-ac4mannaz-80-alpha-isomer-chemical-structure-tube.png |
