NB-598 Maleate
NB-598 Maleate is a potent and competitive inhibitor of squalene epoxidase (SE), and suppresses triglyceride biosynthesis through the farnesol pathway. NB-598 (Maleate) is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Catalog Number | E7512 |
| Molecular Formula | C4H11N5.HCl |
| CAS# | 155294-62-5 |
| Inchi | InChI=1S/C4H11N5.ClH/c1-9(2)4(7)8-3(5)6;/h1-2H3,(H5,5,6,7,8);1H |
| Inchi Key | OETHQSJEHLVLGH-UHFFFAOYSA-N |
| SMILES | CN(C)C(=N)N=C(N)N.Cl |
| Size | 1mg |
| Supplier Page | http://www.selleckchem.com/products/nb-598-maleate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e7512-nb-598-maleate-chemical-structure-tube.png |
